C16H12FNO2 — CID 71615327
5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]benzamide (PubChem CID 71615327) has the molecular formula C16H12FNO2 and a molecular weight of 269.27 g/mol. Its IUPAC name is 5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]benzamide.
| Compound Name | 5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 71615327 |
| Molecular Formula | C16H12FNO2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 5-fluoro-2-[2-(4-methoxyphenyl)ethynyl]benzamide |
| SMILES | COc1ccc(C#Cc2ccc(F)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C16H12FNO2/c1-20-14-8-3-11(4-9-14)2-5-12-6-7-13(17)10-15(12)16(18)19/h3-4,6-10H,1H3,(H2,18,19) |
| InChIKey | LQVGRIGGYGLEJJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|