C30H26N6O6S2 — CID 142840319
2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxamide (PubChem CID 142840319) has the molecular formula C30H26N6O6S2 and a molecular weight of 630.71 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 142840319 |
| Molecular Formula | C30H26N6O6S2 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | 2-(carbamoylamino)-5-[2-(4-methoxyphenyl)ethynyl]thiophene-3-carboxamide |
| SMILES | COc1ccc(C#Cc2cc(C(N)=O)c(NC(N)=O)s2)cc1.COc1ccc(C#Cc2cc(C(N)=O)c(NC(N)=O)s2)cc1 |
| InChI | InChI=1S/2C15H13N3O3S/c2*1-21-10-5-2-9(3-6-10)4-7-11-8-12(13(16)19)14(22-11)18-15(17)20/h2*2-3,5-6,8H,1H3,(H2,16,19)(H3,17,18,20) |
| InChIKey | QOVGNAANNJGIAM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 214.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|