C23H21NO5S — CID 54583604
[2-amino-5-[2-(4-methoxyphenyl)ethynyl]thiophen-3-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 54583604) has the molecular formula C23H21NO5S and a molecular weight of 423.49 g/mol. Its IUPAC name is [2-amino-5-[2-(4-methoxyphenyl)ethynyl]thiophen-3-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [2-amino-5-[2-(4-methoxyphenyl)ethynyl]thiophen-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 54583604 |
| Molecular Formula | C23H21NO5S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [2-amino-5-[2-(4-methoxyphenyl)ethynyl]thiophen-3-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1ccc(C#Cc2cc(C(=O)c3cc(OC)c(OC)c(OC)c3)c(N)s2)cc1 |
| InChI | InChI=1S/C23H21NO5S/c1-26-16-8-5-14(6-9-16)7-10-17-13-18(23(24)30-17)21(25)15-11-19(27-2)22(29-4)20(12-15)28-3/h5-6,8-9,11-13H,24H2,1-4H3 |
| InChIKey | YCWSKPOHJLXLAK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|