C19H19N5O5S — CID 25138006
methyl N-[3-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]anilino]-3-oxopropyl]carbamate (PubChem CID 25138006) has the molecular formula C19H19N5O5S and a molecular weight of 429.46 g/mol. Its IUPAC name is methyl N-[3-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]anilino]-3-oxopropyl]carbamate.
| Compound Name | methyl N-[3-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]anilino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 25138006 |
| Molecular Formula | C19H19N5O5S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | methyl N-[3-[3-[2-[4-carbamoyl-5-(carbamoylamino)thiophen-2-yl]ethynyl]anilino]-3-oxopropyl]carbamate |
| SMILES | COC(=O)NCCC(=O)Nc1cccc(C#Cc2cc(C(N)=O)c(NC(N)=O)s2)c1 |
| InChI | InChI=1S/C19H19N5O5S/c1-29-19(28)22-8-7-15(25)23-12-4-2-3-11(9-12)5-6-13-10-14(16(20)26)17(30-13)24-18(21)27/h2-4,9-10H,7-8H2,1H3,(H2,20,26)(H,22,28)(H,23,25)(H3,21,24,27) |
| InChIKey | SBYYFZLSQVOESG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|