C6H10N2O2S — CID 143129524
2-[2-(hydroxyamino)-4-methyl-1,3-thiazol-5-yl]ethanol (PubChem CID 143129524) has the molecular formula C6H10N2O2S and a molecular weight of 174.22 g/mol. Its IUPAC name is 2-[2-(hydroxyamino)-4-methyl-1,3-thiazol-5-yl]ethanol.
| Compound Name | 2-[2-(hydroxyamino)-4-methyl-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 143129524 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 2-[2-(hydroxyamino)-4-methyl-1,3-thiazol-5-yl]ethanol |
| SMILES | Cc1nc(NO)sc1CCO |
| InChI | InChI=1S/C6H10N2O2S/c1-4-5(2-3-9)11-6(7-4)8-10/h9-10H,2-3H2,1H3,(H,7,8) |
| InChIKey | OWMBHBXSJSDDCI-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|