C12H15N3S — CID 94776574
[4-methyl-5-(2-phenylethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 94776574) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is [4-methyl-5-(2-phenylethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-methyl-5-(2-phenylethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 94776574 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [4-methyl-5-(2-phenylethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | Cc1nc(NN)sc1CCc1ccccc1 |
| InChI | InChI=1S/C12H15N3S/c1-9-11(16-12(14-9)15-13)8-7-10-5-3-2-4-6-10/h2-6H,7-8,13H2,1H3,(H,14,15) |
| InChIKey | XSFXQVMIFKCAPE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|