C12H14N2O — CID 143129716
3,6-dimethyl-4-[[(2E)-penta-2,4-dienylidene]amino]-1H-pyridin-2-one (PubChem CID 143129716) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3,6-dimethyl-4-[[(2E)-penta-2,4-dienylidene]amino]-1H-pyridin-2-one.
| Compound Name | 3,6-dimethyl-4-[[(2E)-penta-2,4-dienylidene]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 143129716 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3,6-dimethyl-4-[[(2E)-penta-2,4-dienylidene]amino]-1H-pyridin-2-one |
| SMILES | C=C/C=C/C=N/c1cc(C)[nH]c(=O)c1C |
| InChI | InChI=1S/C12H14N2O/c1-4-5-6-7-13-11-8-9(2)14-12(15)10(11)3/h4-8H,1H2,2-3H3,(H,14,15)/b6-5+,13-7+ |
| InChIKey | HPTPDKZFZOJETR-WOXAVFRBSA-N |
| XLogP | 2.44 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|