C27H30N4O3S — CID 143131029
N-butyl-10-cyano-4-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide (PubChem CID 143131029) has the molecular formula C27H30N4O3S and a molecular weight of 490.63 g/mol. Its IUPAC name is N-butyl-10-cyano-4-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide.
| Compound Name | N-butyl-10-cyano-4-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
|---|---|
| PubChem CID | 143131029 |
| Molecular Formula | C27H30N4O3S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-butyl-10-cyano-4-[2-[4-(2-hydroxyethyl)phenyl]ethyl]-3-oxo-5H-[1,4]thiazepino[7,6-b]indole-5-carboxamide |
| SMILES | CCCCNC(=O)C1c2c(n(C#N)c3ccccc23)SCC(=O)N1CCc1ccc(CCO)cc1 |
| InChI | InChI=1S/C27H30N4O3S/c1-2-3-14-29-26(34)25-24-21-6-4-5-7-22(21)31(18-28)27(24)35-17-23(33)30(25)15-12-19-8-10-20(11-9-19)13-16-32/h4-11,25,32H,2-3,12-17H2,1H3,(H,29,34) |
| InChIKey | ZIYBXSYYOIZFJQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|