C29H43N3O3 — CID 143131089
4-[2-(4-ethoxy-N-methylanilino)-2-methylpropyl]-2-methylfuro[3,2-b]pyrrole-5-carbaldehyde;N-methylcycloheptanamine (PubChem CID 143131089) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is 4-[2-(4-ethoxy-N-methylanilino)-2-methylpropyl]-2-methylfuro[3,2-b]pyrrole-5-carbaldehyde;N-methylcycloheptanamine.
| Compound Name | 4-[2-(4-ethoxy-N-methylanilino)-2-methylpropyl]-2-methylfuro[3,2-b]pyrrole-5-carbaldehyde;N-methylcycloheptanamine |
|---|---|
| PubChem CID | 143131089 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | 4-[2-(4-ethoxy-N-methylanilino)-2-methylpropyl]-2-methylfuro[3,2-b]pyrrole-5-carbaldehyde;N-methylcycloheptanamine |
| SMILES | CCOc1ccc(N(C)C(C)(C)Cn2c(C=O)cc3oc(C)cc32)cc1.CNC1CCCCCC1 |
| InChI | InChI=1S/C21H26N2O3.C8H17N/c1-6-25-18-9-7-16(8-10-18)22(5)21(3,4)14-23-17(13-24)12-20-19(23)11-15(2)26-20;1-9-8-6-4-2-3-5-7-8/h7-13H,6,14H2,1-5H3;8-9H,2-7H2,1H3 |
| InChIKey | CDYRPTYMKZJCCR-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|