C20H20N2O4S2 — CID 143132501
methyl 2-[[2-[2-[(2-methoxy-2-oxoethyl)carbamothioyl]phenyl]benzenecarbothioyl]amino]acetate (PubChem CID 143132501) has the molecular formula C20H20N2O4S2 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 2-[[2-[2-[(2-methoxy-2-oxoethyl)carbamothioyl]phenyl]benzenecarbothioyl]amino]acetate.
| Compound Name | methyl 2-[[2-[2-[(2-methoxy-2-oxoethyl)carbamothioyl]phenyl]benzenecarbothioyl]amino]acetate |
|---|---|
| PubChem CID | 143132501 |
| Molecular Formula | C20H20N2O4S2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | methyl 2-[[2-[2-[(2-methoxy-2-oxoethyl)carbamothioyl]phenyl]benzenecarbothioyl]amino]acetate |
| SMILES | COC(=O)CNC(=S)c1ccccc1-c1ccccc1C(=S)NCC(=O)OC |
| InChI | InChI=1S/C20H20N2O4S2/c1-25-17(23)11-21-19(27)15-9-5-3-7-13(15)14-8-4-6-10-16(14)20(28)22-12-18(24)26-2/h3-10H,11-12H2,1-2H3,(H,21,27)(H,22,28) |
| InChIKey | MAKIDJLONGQFQZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|