C9H11NO2S2 — CID 54298856
methyl 2-[(5-methylthiophene-2-carbothioyl)amino]acetate (PubChem CID 54298856) has the molecular formula C9H11NO2S2 and a molecular weight of 229.33 g/mol. Its IUPAC name is methyl 2-[(5-methylthiophene-2-carbothioyl)amino]acetate.
| Compound Name | methyl 2-[(5-methylthiophene-2-carbothioyl)amino]acetate |
|---|---|
| PubChem CID | 54298856 |
| Molecular Formula | C9H11NO2S2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | methyl 2-[(5-methylthiophene-2-carbothioyl)amino]acetate |
| SMILES | COC(=O)CNC(=S)c1ccc(C)s1 |
| InChI | InChI=1S/C9H11NO2S2/c1-6-3-4-7(14-6)9(13)10-5-8(11)12-2/h3-4H,5H2,1-2H3,(H,10,13) |
| InChIKey | SCSRVGAODNNWNV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|