About (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol
(3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol (PubChem CID 143135261) has the molecular formula C9H13F2NO
and a molecular weight of 189.20 g/mol. Its IUPAC name is (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol.
Molecular Properties
| Compound Name | (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol |
| PubChem CID | 143135261 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol |
| SMILES | C=C(O)C(/C=N/C)=C(/C)C(C)(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-6(9(3,10)11)8(5-12-4)7(2)13/h5,13H,2H2,1,3-4H3/b8-6-,12-5+ |
| InChIKey | WNEQTQSKPZLFRE-OMECLTFGSA-N |
| XLogP | 2.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol?
The IUPAC name of (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol (CID 143135261) is (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol.
What is the SMILES notation for (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol?
The canonical SMILES for (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol is C=C(O)C(/C=N/C)=C(/C)C(C)(F)F.
What is the InChIKey of (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol?
The InChIKey is WNEQTQSKPZLFRE-OMECLTFGSA-N. The full InChI is InChI=1S/C9H13F2NO/c1-6(9(3,10)11)8(5-12-4)7(2)13/h5,13H,2H2,1,3-4H3/b8-6-,12-5+.
What are the key properties of (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol?
(3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol has a molecular weight of 189.20 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol is sourced from PubChem (CID 143135261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).