C9H13F2NO — CID 143135261
(3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol (PubChem CID 143135261) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol.
| Compound Name | (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol |
|---|---|
| PubChem CID | 143135261 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (3Z)-5,5-difluoro-4-methyl-3-(methyliminomethyl)hexa-1,3-dien-2-ol |
| SMILES | C=C(O)C(/C=N/C)=C(/C)C(C)(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-6(9(3,10)11)8(5-12-4)7(2)13/h5,13H,2H2,1,3-4H3/b8-6-,12-5+ |
| InChIKey | WNEQTQSKPZLFRE-OMECLTFGSA-N |
| XLogP | 2.73 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|