C8H11NO2 — CID 145278339
(3E)-5-(methyliminomethyl)hexa-1,3,5-triene-2,3-diol (PubChem CID 145278339) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (3E)-5-(methyliminomethyl)hexa-1,3,5-triene-2,3-diol.
| Compound Name | (3E)-5-(methyliminomethyl)hexa-1,3,5-triene-2,3-diol |
|---|---|
| PubChem CID | 145278339 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (3E)-5-(methyliminomethyl)hexa-1,3,5-triene-2,3-diol |
| SMILES | C=C(/C=N/C)/C=C(/O)C(=C)O |
| InChI | InChI=1S/C8H11NO2/c1-6(5-9-3)4-8(11)7(2)10/h4-5,10-11H,1-2H2,3H3/b8-4+,9-5+ |
| InChIKey | OEZQPVVQNBUQGX-KBXRYBNXSA-N |
| XLogP | 1.76 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|