C16H23NO5 — CID 123998494
4-[2,5-dimethyl-7-(methyliminomethyl)-4-oxoocta-5,7-dienoxy]-4-oxobutanoic acid (PubChem CID 123998494) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 4-[2,5-dimethyl-7-(methyliminomethyl)-4-oxoocta-5,7-dienoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2,5-dimethyl-7-(methyliminomethyl)-4-oxoocta-5,7-dienoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123998494 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-[2,5-dimethyl-7-(methyliminomethyl)-4-oxoocta-5,7-dienoxy]-4-oxobutanoic acid |
| SMILES | C=C(C=C(C)C(=O)CC(C)COC(=O)CCC(=O)O)/C=N/C |
| InChI | InChI=1S/C16H23NO5/c1-11(9-17-4)7-13(3)14(18)8-12(2)10-22-16(21)6-5-15(19)20/h7,9,12H,1,5-6,8,10H2,2-4H3,(H,19,20)/b13-7?,17-9+ |
| InChIKey | UNVUWZRSVFVGII-JQGWZLHVSA-N |
| XLogP | 2.19 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|