C44H34NO2P — CID 143137489
N-(cyclododecahexaenyl)-N-[(1R)-1-naphthalen-1-ylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 143137489) has the molecular formula C44H34NO2P and a molecular weight of 639.74 g/mol. Its IUPAC name is N-(cyclododecahexaenyl)-N-[(1R)-1-naphthalen-1-ylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | N-(cyclododecahexaenyl)-N-[(1R)-1-naphthalen-1-ylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 143137489 |
| Molecular Formula | C44H34NO2P |
| Molecular Weight | 639.74 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | N-(cyclododecahexaenyl)-N-[(1R)-1-naphthalen-1-ylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | C[C@H](c1cccc2ccccc12)N(C1=C/C=C\C=C/C=C\C=C/C=C\1)p1oc2ccc3ccccc3c2c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C44H34NO2P/c1-32(37-27-17-21-33-18-11-14-24-38(33)37)45(36-22-9-7-5-3-2-4-6-8-10-23-36)48-46-41-30-28-34-19-12-15-25-39(34)43(41)44-40-26-16-13-20-35(40)29-31-42(44)47-48/h2-32H,1H3/b3-2-,4-2-,5-3-,6-4-,7-5-,8-6-,9-7-,10-8-,22-9-,23-10-,36-22+,36-23+/t32-/m1/s1 |
| InChIKey | IWWOSZCKDBGIDA-UHAKMZPYSA-N |
| XLogP | 13.13 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.74 |
| LogP ≤ 5 | 13.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |