C34H32NO2P — CID 143241818
N-[(Z,2S)-hex-4-en-2-yl]-N-[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 143241818) has the molecular formula C34H32NO2P and a molecular weight of 517.61 g/mol. Its IUPAC name is N-[(Z,2S)-hex-4-en-2-yl]-N-[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | N-[(Z,2S)-hex-4-en-2-yl]-N-[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 143241818 |
| Molecular Formula | C34H32NO2P |
| Molecular Weight | 517.61 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | N-[(Z,2S)-hex-4-en-2-yl]-N-[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | C/C=C\C[C@H](C)N([C@@H](C)c1ccccc1)p1oc2ccc3ccccc3c2c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C34H32NO2P/c1-4-5-13-24(2)35(25(3)26-14-7-6-8-15-26)38-36-31-22-20-27-16-9-11-18-29(27)33(31)34-30-19-12-10-17-28(30)21-23-32(34)37-38/h4-12,14-25H,13H2,1-3H3/b5-4-/t24-,25-/m0/s1 |
| InChIKey | BHTZUEXCPUGUJV-BNPWMUJRSA-N |
| XLogP | 10.65 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.61 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|