C41H52NO2PSi2 — CID 163464710
10,16-bis[diethyl(methyl)silyl]-N-[(1R)-1-phenylethyl]-N-propan-2-yl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine (PubChem CID 163464710) has the molecular formula C41H52NO2PSi2 and a molecular weight of 678.02 g/mol. Its IUPAC name is 10,16-bis[diethyl(methyl)silyl]-N-[(1R)-1-phenylethyl]-N-propan-2-yl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine.
| Compound Name | 10,16-bis[diethyl(methyl)silyl]-N-[(1R)-1-phenylethyl]-N-propan-2-yl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
|---|---|
| PubChem CID | 163464710 |
| Molecular Formula | C41H52NO2PSi2 |
| Molecular Weight | 678.02 g/mol |
| Exact Mass | 677.33 |
| IUPAC Name | 10,16-bis[diethyl(methyl)silyl]-N-[(1R)-1-phenylethyl]-N-propan-2-yl-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine |
| SMILES | CC[Si](C)(CC)c1cc2ccccc2c2c1op(N(C(C)C)[C@H](C)c1ccccc1)oc1c([Si](C)(CC)CC)cc3ccccc3c12 |
| InChI | InChI=1S/C41H52NO2PSi2/c1-10-46(8,11-2)36-27-32-23-17-19-25-34(32)38-39-35-26-20-18-24-33(35)28-37(47(9,12-3)13-4)41(39)44-45(43-40(36)38)42(29(5)6)30(7)31-21-15-14-16-22-31/h14-30H,10-13H2,1-9H3/t30-/m1/s1 |
| InChIKey | KZOYVLANDWGGCV-SSEXGKCCSA-N |
| XLogP | 12.35 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.02 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|