C37H30CuF3NO5PS — CID 71657966
N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+);trifluoromethanesulfonate (PubChem CID 71657966) has the molecular formula C37H30CuF3NO5PS and a molecular weight of 752.23 g/mol. Its IUPAC name is N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+);trifluoromethanesulfonate.
| Compound Name | N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+);trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71657966 |
| Molecular Formula | C37H30CuF3NO5PS |
| Molecular Weight | 752.23 g/mol |
| Exact Mass | 751.08 |
| IUPAC Name | N,N-bis[(1S)-1-phenylethyl]-12,14-dioxa-13-phosphapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3,5,7,9,16,18,20,22-decaen-13-amine;copper(1+);trifluoromethanesulfonate |
| SMILES | C[C@@H](c1ccccc1)N([C@@H](C)c1ccccc1)p1oc2ccc3ccccc3c2c2c(ccc3ccccc32)o1.O=S(=O)([O-])C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C36H30NO2P.CHF3O3S.Cu/c1-25(27-13-5-3-6-14-27)37(26(2)28-15-7-4-8-16-28)40-38-33-23-21-29-17-9-11-19-31(29)35(33)36-32-20-12-10-18-30(32)22-24-34(36)39-40;2-1(3,4)8(5,6)7;/h3-26H,1-2H3;(H,5,6,7);/q;;+1/p-1/t25-,26-;;/m0../s1 |
| InChIKey | AWCMBXVLAWKPOY-HWTGJJCHSA-M |
| XLogP | 11.11 |
| TPSA | 86.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.23 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|