C18H26FNO4 — CID 143138851
methyl (5S)-5-(4-fluorophenyl)-5-(oxan-2-ylmethylamino)oxypentanoate (PubChem CID 143138851) has the molecular formula C18H26FNO4 and a molecular weight of 339.41 g/mol. Its IUPAC name is methyl (5S)-5-(4-fluorophenyl)-5-(oxan-2-ylmethylamino)oxypentanoate.
| Compound Name | methyl (5S)-5-(4-fluorophenyl)-5-(oxan-2-ylmethylamino)oxypentanoate |
|---|---|
| PubChem CID | 143138851 |
| Molecular Formula | C18H26FNO4 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | methyl (5S)-5-(4-fluorophenyl)-5-(oxan-2-ylmethylamino)oxypentanoate |
| SMILES | COC(=O)CCC[C@H](ONCC1CCCCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FNO4/c1-22-18(21)7-4-6-17(14-8-10-15(19)11-9-14)24-20-13-16-5-2-3-12-23-16/h8-11,16-17,20H,2-7,12-13H2,1H3/t16?,17-/m0/s1 |
| InChIKey | ZFDGDGGOUDJINS-DJNXLDHESA-N |
| XLogP | 3.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|