C13H20 — CID 143139485
5-ethynyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene (PubChem CID 143139485) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 5-ethynyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene.
| Compound Name | 5-ethynyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene |
|---|---|
| PubChem CID | 143139485 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 5-ethynyl-2,3,4,4a,5,6,7,8,9,9a-decahydro-1H-benzo[7]annulene |
| SMILES | C#CC1CCCCC2CCCCC12 |
| InChI | InChI=1S/C13H20/c1-2-11-7-3-4-8-12-9-5-6-10-13(11)12/h1,11-13H,3-10H2 |
| InChIKey | WLSTUXKGZOZCKK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|