C23H25ClFNO4S — CID 143139587
butane;6-[(2-chloro-6-fluorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxo-7-sulfanylquinoline-3-carboxylic acid (PubChem CID 143139587) has the molecular formula C23H25ClFNO4S and a molecular weight of 465.97 g/mol. Its IUPAC name is butane;6-[(2-chloro-6-fluorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxo-7-sulfanylquinoline-3-carboxylic acid.
| Compound Name | butane;6-[(2-chloro-6-fluorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxo-7-sulfanylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143139587 |
| Molecular Formula | C23H25ClFNO4S |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | butane;6-[(2-chloro-6-fluorophenyl)methyl]-1-(2-hydroxyethyl)-4-oxo-7-sulfanylquinoline-3-carboxylic acid |
| SMILES | CCCC.O=C(O)c1cn(CCO)c2cc(S)c(Cc3c(F)cccc3Cl)cc2c1=O |
| InChI | InChI=1S/C19H15ClFNO4S.C4H10/c20-14-2-1-3-15(21)11(14)6-10-7-12-16(8-17(10)27)22(4-5-23)9-13(18(12)24)19(25)26;1-3-4-2/h1-3,7-9,23,27H,4-6H2,(H,25,26);3-4H2,1-2H3 |
| InChIKey | HZPVRCHQDLRUEQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|