C16H22O — CID 143140434
1-ethyl-3-(4-methoxyhepta-1,6-dien-4-yl)benzene (PubChem CID 143140434) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-ethyl-3-(4-methoxyhepta-1,6-dien-4-yl)benzene.
| Compound Name | 1-ethyl-3-(4-methoxyhepta-1,6-dien-4-yl)benzene |
|---|---|
| PubChem CID | 143140434 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-ethyl-3-(4-methoxyhepta-1,6-dien-4-yl)benzene |
| SMILES | C=CCC(CC=C)(OC)c1cccc(CC)c1 |
| InChI | InChI=1S/C16H22O/c1-5-11-16(17-4,12-6-2)15-10-8-9-14(7-3)13-15/h5-6,8-10,13H,1-2,7,11-12H2,3-4H3 |
| InChIKey | SNVJNJXIIYRZKL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|