C19H23NO2 — CID 143140625
N-(1,3-benzodioxol-5-ylmethyl)-2-(2-ethyl-6-methylphenyl)ethanamine (PubChem CID 143140625) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(2-ethyl-6-methylphenyl)ethanamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-ethyl-6-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 143140625 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(2-ethyl-6-methylphenyl)ethanamine |
| SMILES | CCc1cccc(C)c1CCNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H23NO2/c1-3-16-6-4-5-14(2)17(16)9-10-20-12-15-7-8-18-19(11-15)22-13-21-18/h4-8,11,20H,3,9-10,12-13H2,1-2H3 |
| InChIKey | LFHVPINATFAEGX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|