C18H31F2N — CID 143142075
7,7-difluoro-4-methyl-3-methylidene-N-prop-2-enyloct-1-en-2-amine;3-methylbut-1-ene (PubChem CID 143142075) has the molecular formula C18H31F2N and a molecular weight of 299.45 g/mol. Its IUPAC name is 7,7-difluoro-4-methyl-3-methylidene-N-prop-2-enyloct-1-en-2-amine;3-methylbut-1-ene.
| Compound Name | 7,7-difluoro-4-methyl-3-methylidene-N-prop-2-enyloct-1-en-2-amine;3-methylbut-1-ene |
|---|---|
| PubChem CID | 143142075 |
| Molecular Formula | C18H31F2N |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 7,7-difluoro-4-methyl-3-methylidene-N-prop-2-enyloct-1-en-2-amine;3-methylbut-1-ene |
| SMILES | C=CC(C)C.C=CCNC(=C)C(=C)C(C)CCC(C)(F)F |
| InChI | InChI=1S/C13H21F2N.C5H10/c1-6-9-16-12(4)11(3)10(2)7-8-13(5,14)15;1-4-5(2)3/h6,10,16H,1,3-4,7-9H2,2,5H3;4-5H,1H2,2-3H3 |
| InChIKey | PEXRHQWOHKSMQI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|