C18H20BrN5 — CID 143142756
6-bromo-3-methyl-4-propan-2-yl-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]pyridine (PubChem CID 143142756) has the molecular formula C18H20BrN5 and a molecular weight of 386.30 g/mol. Its IUPAC name is 6-bromo-3-methyl-4-propan-2-yl-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]pyridine.
| Compound Name | 6-bromo-3-methyl-4-propan-2-yl-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]pyridine |
|---|---|
| PubChem CID | 143142756 |
| Molecular Formula | C18H20BrN5 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 6-bromo-3-methyl-4-propan-2-yl-2-[2-[4-(2H-tetrazol-5-yl)phenyl]ethyl]pyridine |
| SMILES | Cc1c(C(C)C)cc(Br)nc1CCc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C18H20BrN5/c1-11(2)15-10-17(19)20-16(12(15)3)9-6-13-4-7-14(8-5-13)18-21-23-24-22-18/h4-5,7-8,10-11H,6,9H2,1-3H3,(H,21,22,23,24) |
| InChIKey | LFXWNKDKRXMCBM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|