C24H19ClN2O2S — CID 143142849
2-[4-(4-chlorophenyl)-2-[(4-methoxyphenyl)-pyridin-2-ylmethyl]-1,3-thiazol-5-yl]acetaldehyde (PubChem CID 143142849) has the molecular formula C24H19ClN2O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2-[(4-methoxyphenyl)-pyridin-2-ylmethyl]-1,3-thiazol-5-yl]acetaldehyde.
| Compound Name | 2-[4-(4-chlorophenyl)-2-[(4-methoxyphenyl)-pyridin-2-ylmethyl]-1,3-thiazol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 143142849 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2-[(4-methoxyphenyl)-pyridin-2-ylmethyl]-1,3-thiazol-5-yl]acetaldehyde |
| SMILES | COc1ccc(C(c2ccccn2)c2nc(-c3ccc(Cl)cc3)c(CC=O)s2)cc1 |
| InChI | InChI=1S/C24H19ClN2O2S/c1-29-19-11-7-16(8-12-19)22(20-4-2-3-14-26-20)24-27-23(21(30-24)13-15-28)17-5-9-18(25)10-6-17/h2-12,14-15,22H,13H2,1H3 |
| InChIKey | AFZRNCMVVRGAMJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|