About 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane
2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane (PubChem CID 143143145) has the molecular formula C15H23BrN2O3
and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane.
Molecular Properties
| Compound Name | 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane |
| PubChem CID | 143143145 |
| Molecular Formula | C15H23BrN2O3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane |
| SMILES | CC.CCCC(=O)OCC(C)O/N=C/c1ccc(Br)cn1 |
| InChI | InChI=1S/C13H17BrN2O3.C2H6/c1-3-4-13(17)18-9-10(2)19-16-8-12-6-5-11(14)7-15-12;1-2/h5-8,10H,3-4,9H2,1-2H3;1-2H3/b16-8+; |
| InChIKey | UUXAJYGPJRGYLX-OHGISNTKSA-N |
| XLogP | 3.95 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane?
The IUPAC name of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane (CID 143143145) is 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane.
What is the SMILES notation for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane?
The canonical SMILES for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane is CC.CCCC(=O)OCC(C)O/N=C/c1ccc(Br)cn1.
What is the InChIKey of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane?
The InChIKey is UUXAJYGPJRGYLX-OHGISNTKSA-N. The full InChI is InChI=1S/C13H17BrN2O3.C2H6/c1-3-4-13(17)18-9-10(2)19-16-8-12-6-5-11(14)7-15-12;1-2/h5-8,10H,3-4,9H2,1-2H3;1-2H3/b16-8+;.
What are the key properties of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane?
2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane has a molecular weight of 359.26 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxypropyl butanoate;ethane is sourced from PubChem (CID 143143145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).