About 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate
2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate (PubChem CID 143143130) has the molecular formula C11H15BrN2O3S
and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate.
Molecular Properties
| Compound Name | 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate |
| PubChem CID | 143143130 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate |
| SMILES | CCC(COS(C)=O)O/N=C/c1ccc(Br)cn1 |
| InChI | InChI=1S/C11H15BrN2O3S/c1-3-11(8-16-18(2)15)17-14-7-10-5-4-9(12)6-13-10/h4-7,11H,3,8H2,1-2H3/b14-7+ |
| InChIKey | HFRKLQYXOGUIJL-VGOFMYFVSA-N |
| XLogP | 2.28 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate?
The IUPAC name of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate (CID 143143130) is 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate.
What is the SMILES notation for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate?
The canonical SMILES for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate is CCC(COS(C)=O)O/N=C/c1ccc(Br)cn1.
What is the InChIKey of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate?
The InChIKey is HFRKLQYXOGUIJL-VGOFMYFVSA-N. The full InChI is InChI=1S/C11H15BrN2O3S/c1-3-11(8-16-18(2)15)17-14-7-10-5-4-9(12)6-13-10/h4-7,11H,3,8H2,1-2H3/b14-7+.
What are the key properties of 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate?
2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate has a molecular weight of 335.22 g/mol, XLogP of 2.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-(5-bromo-2-pyridinyl)methylideneamino]oxybutyl methanesulfinate is sourced from PubChem (CID 143143130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).