C10H9N4ORbS — CID 143143331
rubidium(1+);[3-(1,3-thiazol-2-ylamino)phenyl]carbamoylazanide (PubChem CID 143143331) has the molecular formula C10H9N4ORbS and a molecular weight of 318.74 g/mol. Its IUPAC name is rubidium(1+);[3-(1,3-thiazol-2-ylamino)phenyl]carbamoylazanide.
| Compound Name | rubidium(1+);[3-(1,3-thiazol-2-ylamino)phenyl]carbamoylazanide |
|---|---|
| PubChem CID | 143143331 |
| Molecular Formula | C10H9N4ORbS |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | rubidium(1+);[3-(1,3-thiazol-2-ylamino)phenyl]carbamoylazanide |
| SMILES | [NH-]C(=O)Nc1cccc(Nc2nccs2)c1.[Rb+] |
| InChI | InChI=1S/C10H10N4OS.Rb/c11-9(15)13-7-2-1-3-8(6-7)14-10-12-4-5-16-10;/h1-6H,(H4,11,12,13,14,15);/q;+1/p-1 |
| InChIKey | XPXZSTXBGQLJOE-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |