C12H12N2S — CID 174465253
N-(3-cyclopropylphenyl)-1,3-thiazol-2-amine (PubChem CID 174465253) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is N-(3-cyclopropylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-(3-cyclopropylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 174465253 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-(3-cyclopropylphenyl)-1,3-thiazol-2-amine |
| SMILES | c1cc(Nc2nccs2)cc(C2CC2)c1 |
| InChI | InChI=1S/C12H12N2S/c1-2-10(9-4-5-9)8-11(3-1)14-12-13-6-7-15-12/h1-3,6-9H,4-5H2,(H,13,14) |
| InChIKey | IVPHVOWWZAGDAZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |