C34H45N5O3 — CID 143145704
6-ethyl-8-[(3E,4Z,6Z)-3-ethylidene-2-phenylocta-4,6-dienyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145704) has the molecular formula C34H45N5O3 and a molecular weight of 571.77 g/mol. Its IUPAC name is 6-ethyl-8-[(3E,4Z,6Z)-3-ethylidene-2-phenylocta-4,6-dienyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | 6-ethyl-8-[(3E,4Z,6Z)-3-ethylidene-2-phenylocta-4,6-dienyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145704 |
| Molecular Formula | C34H45N5O3 |
| Molecular Weight | 571.77 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 6-ethyl-8-[(3E,4Z,6Z)-3-ethylidene-2-phenylocta-4,6-dienyl]-N-[(4-methoxyphenyl)methyl]-2-methyl-4-oxo-6,7,9,9a-tetrahydro-3H-pyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C/C=C\C=C/C(=C\C)C(CN1CC(CC)N2C(=O)CN(C)N(C(=O)NCc3ccc(OC)cc3)C2C1)c1ccccc1 |
| InChI | InChI=1S/C34H45N5O3/c1-6-9-11-14-27(7-2)31(28-15-12-10-13-16-28)23-37-22-29(8-3)38-32(24-37)39(36(4)25-33(38)40)34(41)35-21-26-17-19-30(42-5)20-18-26/h6-7,9-20,29,31-32H,8,21-25H2,1-5H3,(H,35,41)/b9-6-,14-11-,27-7+ |
| InChIKey | BFTCIMQZGRPETD-LNXRGNKKSA-N |
| XLogP | 5.18 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.77 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|