C36H39N5O3 — CID 89355191
(6S,9aS)-N-benzyl-2-methyl-8-[(4Z,6Z)-3-methylidene-2-phenylocta-4,6-dienyl]-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 89355191) has the molecular formula C36H39N5O3 and a molecular weight of 589.74 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-2-methyl-8-[(4Z,6Z)-3-methylidene-2-phenylocta-4,6-dienyl]-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-2-methyl-8-[(4Z,6Z)-3-methylidene-2-phenylocta-4,6-dienyl]-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 89355191 |
| Molecular Formula | C36H39N5O3 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | (6S,9aS)-N-benzyl-2-methyl-8-[(4Z,6Z)-3-methylidene-2-phenylocta-4,6-dienyl]-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=C(/C=C\C=C/C)C(CN1C[C@H]2N(C(=O)CN(C)N2C(=O)NCc2ccccc2)[C@@H](c2ccccc2)C1=O)c1ccccc1 |
| InChI | InChI=1S/C36H39N5O3/c1-4-5-9-16-27(2)31(29-19-12-7-13-20-29)24-39-25-32-40(34(35(39)43)30-21-14-8-15-22-30)33(42)26-38(3)41(32)36(44)37-23-28-17-10-6-11-18-28/h4-22,31-32,34H,2,23-26H2,1,3H3,(H,37,44)/b5-4-,16-9-/t31?,32-,34-/m0/s1 |
| InChIKey | FOGGGGWIFPXMPU-OWKFPLISSA-N |
| XLogP | 5.27 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|