C14H19BrN2O4 — CID 143146128
2-methylbutan-2-yl 5-bromo-4-(ethoxycarbonylamino)pyridine-2-carboxylate (PubChem CID 143146128) has the molecular formula C14H19BrN2O4 and a molecular weight of 359.22 g/mol. Its IUPAC name is 2-methylbutan-2-yl 5-bromo-4-(ethoxycarbonylamino)pyridine-2-carboxylate.
| Compound Name | 2-methylbutan-2-yl 5-bromo-4-(ethoxycarbonylamino)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 143146128 |
| Molecular Formula | C14H19BrN2O4 |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-methylbutan-2-yl 5-bromo-4-(ethoxycarbonylamino)pyridine-2-carboxylate |
| SMILES | CCOC(=O)Nc1cc(C(=O)OC(C)(C)CC)ncc1Br |
| InChI | InChI=1S/C14H19BrN2O4/c1-5-14(3,4)21-12(18)11-7-10(9(15)8-16-11)17-13(19)20-6-2/h7-8H,5-6H2,1-4H3,(H,16,17,19) |
| InChIKey | UMUUSVHVIHSIOQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |