C9H18N2 — CID 143147779
(E)-3-ethyl-N-methyl-5-methyliminopent-3-en-1-amine (PubChem CID 143147779) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (E)-3-ethyl-N-methyl-5-methyliminopent-3-en-1-amine.
| Compound Name | (E)-3-ethyl-N-methyl-5-methyliminopent-3-en-1-amine |
|---|---|
| PubChem CID | 143147779 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (E)-3-ethyl-N-methyl-5-methyliminopent-3-en-1-amine |
| SMILES | CC/C(=C\C=N\C)CCNC |
| InChI | InChI=1S/C9H18N2/c1-4-9(5-7-10-2)6-8-11-3/h5,7,11H,4,6,8H2,1-3H3/b9-5+,10-7+ |
| InChIKey | SWQLZFVYGLNZPY-FWMCCXIMSA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|