C17H15BrFN3O2 — CID 143148924
6-bromo-5-ethenyl-4-(ethylideneamino)-N-[(3-fluorophenyl)methyl]-3-hydroxypyridine-2-carboxamide (PubChem CID 143148924) has the molecular formula C17H15BrFN3O2 and a molecular weight of 392.23 g/mol. Its IUPAC name is 6-bromo-5-ethenyl-4-(ethylideneamino)-N-[(3-fluorophenyl)methyl]-3-hydroxypyridine-2-carboxamide.
| Compound Name | 6-bromo-5-ethenyl-4-(ethylideneamino)-N-[(3-fluorophenyl)methyl]-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 143148924 |
| Molecular Formula | C17H15BrFN3O2 |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 6-bromo-5-ethenyl-4-(ethylideneamino)-N-[(3-fluorophenyl)methyl]-3-hydroxypyridine-2-carboxamide |
| SMILES | C=Cc1c(Br)nc(C(=O)NCc2cccc(F)c2)c(O)c1/N=C/C |
| InChI | InChI=1S/C17H15BrFN3O2/c1-3-12-13(20-4-2)15(23)14(22-16(12)18)17(24)21-9-10-6-5-7-11(19)8-10/h3-8,23H,1,9H2,2H3,(H,21,24)/b20-4+ |
| InChIKey | USSITPMZKTUFNU-LRNAUUFOSA-N |
| XLogP | 3.98 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|