C13H17F4N — CID 143151032
4-[(3Z)-3-fluoro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-1-methylpiperidine (PubChem CID 143151032) has the molecular formula C13H17F4N and a molecular weight of 263.28 g/mol. Its IUPAC name is 4-[(3Z)-3-fluoro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-1-methylpiperidine.
| Compound Name | 4-[(3Z)-3-fluoro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 143151032 |
| Molecular Formula | C13H17F4N |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[(3Z)-3-fluoro-4-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-1-methylpiperidine |
| SMILES | C=C/C(=C(/F)C(=C)C1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H17F4N/c1-4-11(13(15,16)17)12(14)9(2)10-5-7-18(3)8-6-10/h4,10H,1-2,5-8H2,3H3/b12-11- |
| InChIKey | YBNGXZNQYAPZQP-QXMHVHEDSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|