C19H33F4N3S — CID 143151525
ethane;(2R)-1-(2-fluorophenyl)-4-pyrrolidin-1-ylbutan-2-amine;N-(2,2,2-trifluoroethylsulfanyl)methanamine (PubChem CID 143151525) has the molecular formula C19H33F4N3S and a molecular weight of 411.55 g/mol. Its IUPAC name is ethane;(2R)-1-(2-fluorophenyl)-4-pyrrolidin-1-ylbutan-2-amine;N-(2,2,2-trifluoroethylsulfanyl)methanamine.
| Compound Name | ethane;(2R)-1-(2-fluorophenyl)-4-pyrrolidin-1-ylbutan-2-amine;N-(2,2,2-trifluoroethylsulfanyl)methanamine |
|---|---|
| PubChem CID | 143151525 |
| Molecular Formula | C19H33F4N3S |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | ethane;(2R)-1-(2-fluorophenyl)-4-pyrrolidin-1-ylbutan-2-amine;N-(2,2,2-trifluoroethylsulfanyl)methanamine |
| SMILES | CC.CNSCC(F)(F)F.N[C@@H](CCN1CCCC1)Cc1ccccc1F |
| InChI | InChI=1S/C14H21FN2.C3H6F3NS.C2H6/c15-14-6-2-1-5-12(14)11-13(16)7-10-17-8-3-4-9-17;1-7-8-2-3(4,5)6;1-2/h1-2,5-6,13H,3-4,7-11,16H2;7H,2H2,1H3;1-2H3/t13-;;/m0../s1 |
| InChIKey | IKXASEJYLVJKQU-GXKRWWSZSA-N |
| XLogP | 4.62 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|