C22H30FN5 — CID 143290721
(2R)-1-(2-fluorophenyl)-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]butan-2-amine (PubChem CID 143290721) has the molecular formula C22H30FN5 and a molecular weight of 383.51 g/mol. Its IUPAC name is (2R)-1-(2-fluorophenyl)-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]butan-2-amine.
| Compound Name | (2R)-1-(2-fluorophenyl)-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]butan-2-amine |
|---|---|
| PubChem CID | 143290721 |
| Molecular Formula | C22H30FN5 |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | (2R)-1-(2-fluorophenyl)-4-[3-(4-pyridin-2-ylpiperazin-1-yl)azetidin-1-yl]butan-2-amine |
| SMILES | N[C@@H](CCN1CC(N2CCN(c3ccccn3)CC2)C1)Cc1ccccc1F |
| InChI | InChI=1S/C22H30FN5/c23-21-6-2-1-5-18(21)15-19(24)8-10-26-16-20(17-26)27-11-13-28(14-12-27)22-7-3-4-9-25-22/h1-7,9,19-20H,8,10-17,24H2/t19-/m0/s1 |
| InChIKey | LMJNGAGUVPWZLG-IBGZPJMESA-N |
| XLogP | 1.99 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |