C24H24FN5O3S — CID 143152782
1-(2-fluoro-4-methylphenyl)-3,6,8-trimethyl-5-[3-(methylsulfanylamino)anilino]pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 143152782) has the molecular formula C24H24FN5O3S and a molecular weight of 481.55 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-3,6,8-trimethyl-5-[3-(methylsulfanylamino)anilino]pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-3,6,8-trimethyl-5-[3-(methylsulfanylamino)anilino]pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 143152782 |
| Molecular Formula | C24H24FN5O3S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-3,6,8-trimethyl-5-[3-(methylsulfanylamino)anilino]pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CSNc1cccc(Nc2c(C)c(=O)n(C)c3c2c(=O)n(C)c(=O)n3-c2ccc(C)cc2F)c1 |
| InChI | InChI=1S/C24H24FN5O3S/c1-13-9-10-18(17(25)11-13)30-21-19(23(32)29(4)24(30)33)20(14(2)22(31)28(21)3)26-15-7-6-8-16(12-15)27-34-5/h6-12,26-27H,1-5H3 |
| InChIKey | BEBIQELZSDCHTJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|