C19H18FN3O3S — CID 177144816
3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethyl-5-sulfanylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 177144816) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethyl-5-sulfanylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethyl-5-sulfanylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 177144816 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethyl-5-sulfanylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1ccc(-n2c(=O)n(C3CC3)c(=O)c3c(S)c(C)c(=O)n(C)c32)c(F)c1 |
| InChI | InChI=1S/C19H18FN3O3S/c1-9-4-7-13(12(20)8-9)23-16-14(15(27)10(2)17(24)21(16)3)18(25)22(19(23)26)11-5-6-11/h4,7-8,11,27H,5-6H2,1-3H3 |
| InChIKey | RKPVPTJFBLWQPO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|