C25H20FIN4O6 — CID 170337239
3-cyclopropyl-1-(2-fluoro-4-iodophenyl)-6,8-dimethyl-5-(2-methyl-3-nitrophenoxy)pyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 170337239) has the molecular formula C25H20FIN4O6 and a molecular weight of 618.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2-fluoro-4-iodophenyl)-6,8-dimethyl-5-(2-methyl-3-nitrophenoxy)pyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 3-cyclopropyl-1-(2-fluoro-4-iodophenyl)-6,8-dimethyl-5-(2-methyl-3-nitrophenoxy)pyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 170337239 |
| Molecular Formula | C25H20FIN4O6 |
| Molecular Weight | 618.36 g/mol |
| Exact Mass | 618.04 |
| IUPAC Name | 3-cyclopropyl-1-(2-fluoro-4-iodophenyl)-6,8-dimethyl-5-(2-methyl-3-nitrophenoxy)pyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1c(Oc2c(C)c(=O)n(C)c3c2c(=O)n(C2CC2)c(=O)n3-c2ccc(I)cc2F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H20FIN4O6/c1-12-17(31(35)36)5-4-6-19(12)37-21-13(2)23(32)28(3)22-20(21)24(33)29(15-8-9-15)25(34)30(22)18-10-7-14(27)11-16(18)26/h4-7,10-11,15H,8-9H2,1-3H3 |
| InChIKey | DXVMOWGJLFXXFE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 118.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|