C25H24FN5O3 — CID 177144822
5-(3-aminoanilino)-3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 177144822) has the molecular formula C25H24FN5O3 and a molecular weight of 461.50 g/mol. Its IUPAC name is 5-(3-aminoanilino)-3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(3-aminoanilino)-3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 177144822 |
| Molecular Formula | C25H24FN5O3 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 5-(3-aminoanilino)-3-cyclopropyl-1-(2-fluoro-4-methylphenyl)-6,8-dimethylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cc1ccc(-n2c(=O)n(C3CC3)c(=O)c3c(Nc4cccc(N)c4)c(C)c(=O)n(C)c32)c(F)c1 |
| InChI | InChI=1S/C25H24FN5O3/c1-13-7-10-19(18(26)11-13)31-22-20(24(33)30(25(31)34)17-8-9-17)21(14(2)23(32)29(22)3)28-16-6-4-5-15(27)12-16/h4-7,10-12,17,28H,8-9,27H2,1-3H3 |
| InChIKey | HLHVHIUHDNIAHA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|