C21H29NO7 — CID 143154399
(2R,3R)-2,3-diacetyloxy-4-oxo-4-(2-phenylpiperidin-1-yl)butanoic acid;ethane (PubChem CID 143154399) has the molecular formula C21H29NO7 and a molecular weight of 407.46 g/mol. Its IUPAC name is (2R,3R)-2,3-diacetyloxy-4-oxo-4-(2-phenylpiperidin-1-yl)butanoic acid;ethane.
| Compound Name | (2R,3R)-2,3-diacetyloxy-4-oxo-4-(2-phenylpiperidin-1-yl)butanoic acid;ethane |
|---|---|
| PubChem CID | 143154399 |
| Molecular Formula | C21H29NO7 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (2R,3R)-2,3-diacetyloxy-4-oxo-4-(2-phenylpiperidin-1-yl)butanoic acid;ethane |
| SMILES | CC.CC(=O)O[C@@H](C(=O)O)[C@@H](OC(C)=O)C(=O)N1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C19H23NO7.C2H6/c1-12(21)26-16(17(19(24)25)27-13(2)22)18(23)20-11-7-6-10-15(20)14-8-4-3-5-9-14;1-2/h3-5,8-9,15-17H,6-7,10-11H2,1-2H3,(H,24,25);1-2H3/t15?,16-,17-;/m1./s1 |
| InChIKey | ZDWNQHUISNHPLZ-SHZZSZNXSA-N |
| XLogP | 2.71 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |