C21H34ClNO4S — CID 143155680
(3R)-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-3-(1-methoxyethoxy)-4-sulfanylidenebutanoic acid;ethane (PubChem CID 143155680) has the molecular formula C21H34ClNO4S and a molecular weight of 432.03 g/mol. Its IUPAC name is (3R)-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-3-(1-methoxyethoxy)-4-sulfanylidenebutanoic acid;ethane.
| Compound Name | (3R)-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-3-(1-methoxyethoxy)-4-sulfanylidenebutanoic acid;ethane |
|---|---|
| PubChem CID | 143155680 |
| Molecular Formula | C21H34ClNO4S |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | (3R)-4-[2-(3-chlorophenyl)pyrrolidin-1-yl]-3-(1-methoxyethoxy)-4-sulfanylidenebutanoic acid;ethane |
| SMILES | CC.CC.COC(C)O[C@H](CC(=O)O)C(=S)N1CCCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H22ClNO4S.2C2H6/c1-11(22-2)23-15(10-16(20)21)17(24)19-8-4-7-14(19)12-5-3-6-13(18)9-12;2*1-2/h3,5-6,9,11,14-15H,4,7-8,10H2,1-2H3,(H,20,21);2*1-2H3/t11?,14?,15-;;/m1../s1 |
| InChIKey | UVSQAFDDHJWHIY-LPGAUPFTSA-N |
| XLogP | 5.71 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|