C18H17NO2S2 — CID 143156137
S-[2-oxo-2-(1-phenylsulfanyl-2,3-dihydroindol-5-yl)ethyl] ethanethioate (PubChem CID 143156137) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is S-[2-oxo-2-(1-phenylsulfanyl-2,3-dihydroindol-5-yl)ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-(1-phenylsulfanyl-2,3-dihydroindol-5-yl)ethyl] ethanethioate |
|---|---|
| PubChem CID | 143156137 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | S-[2-oxo-2-(1-phenylsulfanyl-2,3-dihydroindol-5-yl)ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc2c(c1)CCN2Sc1ccccc1 |
| InChI | InChI=1S/C18H17NO2S2/c1-13(20)22-12-18(21)15-7-8-17-14(11-15)9-10-19(17)23-16-5-3-2-4-6-16/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | IZSUTWWYZSPGAT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|