C19H22N2OS — CID 86817217
1-methyl-N-(2-phenylsulfanylpropyl)-2,3-dihydroindole-5-carboxamide (PubChem CID 86817217) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-methyl-N-(2-phenylsulfanylpropyl)-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-methyl-N-(2-phenylsulfanylpropyl)-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 86817217 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-methyl-N-(2-phenylsulfanylpropyl)-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(CNC(=O)c1ccc2c(c1)CCN2C)Sc1ccccc1 |
| InChI | InChI=1S/C19H22N2OS/c1-14(23-17-6-4-3-5-7-17)13-20-19(22)16-8-9-18-15(12-16)10-11-21(18)2/h3-9,12,14H,10-11,13H2,1-2H3,(H,20,22) |
| InChIKey | NAOJQZXNEQYDQG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |