C24H23F3N2O2S2 — CID 143157862
S-[2-[4-[[2-(1-cyclopropylidene-2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfanylamino]phenyl]-2-oxoethyl] ethanethioate (PubChem CID 143157862) has the molecular formula C24H23F3N2O2S2 and a molecular weight of 492.59 g/mol. Its IUPAC name is S-[2-[4-[[2-(1-cyclopropylidene-2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfanylamino]phenyl]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[4-[[2-(1-cyclopropylidene-2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfanylamino]phenyl]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 143157862 |
| Molecular Formula | C24H23F3N2O2S2 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | S-[2-[4-[[2-(1-cyclopropylidene-2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfanylamino]phenyl]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)c1ccc(NSc2ccc3c(c2)CN(C(=C2CC2)C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C24H23F3N2O2S2/c1-15(30)32-14-22(31)17-4-7-20(8-5-17)28-33-21-9-6-16-10-11-29(13-19(16)12-21)23(18-2-3-18)24(25,26)27/h4-9,12,28H,2-3,10-11,13-14H2,1H3 |
| InChIKey | LCWRUURLPKHDNQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|