C14H20N2 — CID 143157890
ethane;N-[(1Z,3Z)-1-pyridin-4-ylpenta-1,3-dienyl]ethanimine (PubChem CID 143157890) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is ethane;N-[(1Z,3Z)-1-pyridin-4-ylpenta-1,3-dienyl]ethanimine.
| Compound Name | ethane;N-[(1Z,3Z)-1-pyridin-4-ylpenta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 143157890 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | ethane;N-[(1Z,3Z)-1-pyridin-4-ylpenta-1,3-dienyl]ethanimine |
| SMILES | C/C=C\C=C(/N=C/C)c1ccncc1.CC |
| InChI | InChI=1S/C12H14N2.C2H6/c1-3-5-6-12(14-4-2)11-7-9-13-10-8-11;1-2/h3-10H,1-2H3;1-2H3/b5-3-,12-6-,14-4+; |
| InChIKey | PFTICSATDDWIRW-MRGNLKLKSA-N |
| XLogP | 4.12 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|