About ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine
ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine (PubChem CID 143158589) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine.
Molecular Properties
| Compound Name | ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine |
| PubChem CID | 143158589 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine |
| SMILES | CC.CN/N=C/c1ccccc1C.O=CCc1cccc(O)c1 |
| InChI | InChI=1S/C9H12N2.C8H8O2.C2H6/c1-8-5-3-4-6-9(8)7-11-10-2;9-5-4-7-2-1-3-8(10)6-7;1-2/h3-7,10H,1-2H3;1-3,5-6,10H,4H2;1-2H3/b11-7+;; |
| InChIKey | ZWBDNYOFQAVJKL-FCVAESPPSA-N |
| XLogP | 3.71 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine?
The IUPAC name of ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine (CID 143158589) is ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine.
What is the SMILES notation for ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine?
The canonical SMILES for ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine is CC.CN/N=C/c1ccccc1C.O=CCc1cccc(O)c1.
What is the InChIKey of ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine?
The InChIKey is ZWBDNYOFQAVJKL-FCVAESPPSA-N. The full InChI is InChI=1S/C9H12N2.C8H8O2.C2H6/c1-8-5-3-4-6-9(8)7-11-10-2;9-5-4-7-2-1-3-8(10)6-7;1-2/h3-7,10H,1-2H3;1-3,5-6,10H,4H2;1-2H3/b11-7+;;.
What are the key properties of ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine?
ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine has a molecular weight of 314.43 g/mol, XLogP of 3.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(3-hydroxyphenyl)acetaldehyde;N-[(E)-(2-methylphenyl)methylideneamino]methanamine is sourced from PubChem (CID 143158589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).