About 2-methylbenzaldehyde;phenol
2-methylbenzaldehyde;phenol (PubChem CID 88733801) has the molecular formula C14H14O2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-methylbenzaldehyde;phenol.
Molecular Properties
| Compound Name | 2-methylbenzaldehyde;phenol |
| PubChem CID | 88733801 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-methylbenzaldehyde;phenol |
| SMILES | Cc1ccccc1C=O.Oc1ccccc1 |
| InChI | InChI=1S/C8H8O.C6H6O/c1-7-4-2-3-5-8(7)6-9;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7H |
| InChIKey | YLMRBTHELGGFTI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbenzaldehyde;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzaldehyde;phenol?
The IUPAC name of 2-methylbenzaldehyde;phenol (CID 88733801) is 2-methylbenzaldehyde;phenol.
What is the SMILES notation for 2-methylbenzaldehyde;phenol?
The canonical SMILES for 2-methylbenzaldehyde;phenol is Cc1ccccc1C=O.Oc1ccccc1.
What is the InChIKey of 2-methylbenzaldehyde;phenol?
The InChIKey is YLMRBTHELGGFTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C6H6O/c1-7-4-2-3-5-8(7)6-9;7-6-4-2-1-3-5-6/h2-6H,1H3;1-5,7H.
What are the key properties of 2-methylbenzaldehyde;phenol?
2-methylbenzaldehyde;phenol has a molecular weight of 214.26 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzaldehyde;phenol is sourced from PubChem (CID 88733801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).